About 2,2-bis(1-chloroethenyl)-3,3-dimethylcyclopropane-1-carboxylic acid
2,2-bis(1-chloroethenyl)-3,3-dimethylcyclopropane-1-carboxylic acid (PubChem CID 20533205) has the molecular formula C10H12Cl2O2
and a molecular weight of 235.11 g/mol. Its IUPAC name is 2,2-bis(1-chloroethenyl)-3,3-dimethylcyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | 2,2-bis(1-chloroethenyl)-3,3-dimethylcyclopropane-1-carboxylic acid |
| PubChem CID | 20533205 |
| Molecular Formula | C10H12Cl2O2 |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 2,2-bis(1-chloroethenyl)-3,3-dimethylcyclopropane-1-carboxylic acid |
| SMILES | C=C(Cl)C1(C(=C)Cl)C(C(=O)O)C1(C)C |
| InChI | InChI=1S/C10H12Cl2O2/c1-5(11)10(6(2)12)7(8(13)14)9(10,3)4/h7H,1-2H2,3-4H3,(H,13,14) |
| InChIKey | UULXBUIFESVDCZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-bis(1-chloroethenyl)-3,3-dimethylcyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(1-chloroethenyl)-3,3-dimethylcyclopropane-1-carboxylic acid?
The IUPAC name of 2,2-bis(1-chloroethenyl)-3,3-dimethylcyclopropane-1-carboxylic acid (CID 20533205) is 2,2-bis(1-chloroethenyl)-3,3-dimethylcyclopropane-1-carboxylic acid.
What is the SMILES notation for 2,2-bis(1-chloroethenyl)-3,3-dimethylcyclopropane-1-carboxylic acid?
The canonical SMILES for 2,2-bis(1-chloroethenyl)-3,3-dimethylcyclopropane-1-carboxylic acid is C=C(Cl)C1(C(=C)Cl)C(C(=O)O)C1(C)C.
What is the InChIKey of 2,2-bis(1-chloroethenyl)-3,3-dimethylcyclopropane-1-carboxylic acid?
The InChIKey is UULXBUIFESVDCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Cl2O2/c1-5(11)10(6(2)12)7(8(13)14)9(10,3)4/h7H,1-2H2,3-4H3,(H,13,14).
What are the key properties of 2,2-bis(1-chloroethenyl)-3,3-dimethylcyclopropane-1-carboxylic acid?
2,2-bis(1-chloroethenyl)-3,3-dimethylcyclopropane-1-carboxylic acid has a molecular weight of 235.11 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(1-chloroethenyl)-3,3-dimethylcyclopropane-1-carboxylic acid is sourced from PubChem (CID 20533205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).