C8H8BrF5O2 — CID 57041457
2-bromo-3,3-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclopropane-1-carboxylic acid (PubChem CID 57041457) has the molecular formula C8H8BrF5O2 and a molecular weight of 311.04 g/mol. Its IUPAC name is 2-bromo-3,3-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclopropane-1-carboxylic acid.
| Compound Name | 2-bromo-3,3-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 57041457 |
| Molecular Formula | C8H8BrF5O2 |
| Molecular Weight | 311.04 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | 2-bromo-3,3-dimethyl-2-(1,1,2,2,2-pentafluoroethyl)cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(C(=O)O)C1(Br)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8BrF5O2/c1-5(2)3(4(15)16)6(5,9)7(10,11)8(12,13)14/h3H,1-2H3,(H,15,16) |
| InChIKey | RUZSCXDAUSIZLH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.04 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|