C13H23BrHgO — CID 135046850
[(2S,4aS,6S,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-chromen-6-yl]-bromomercury (PubChem CID 135046850) has the molecular formula C13H23BrHgO and a molecular weight of 475.82 g/mol. Its IUPAC name is [(2S,4aS,6S,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-chromen-6-yl]-bromomercury.
| Compound Name | [(2S,4aS,6S,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-chromen-6-yl]-bromomercury |
|---|---|
| PubChem CID | 135046850 |
| Molecular Formula | C13H23BrHgO |
| Molecular Weight | 475.82 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | [(2S,4aS,6S,8aS)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-2H-chromen-6-yl]-bromomercury |
| SMILES | C[C@H]1CC[C@H]2C(C)(C)[C@@H]([Hg]Br)CC[C@]2(C)O1 |
| InChI | InChI=1S/C13H23O.BrH.Hg/c1-10-6-7-11-12(2,3)8-5-9-13(11,4)14-10;;/h8,10-11H,5-7,9H2,1-4H3;1H;/q;;+1/p-1/t10-,11-,13-;;/m0../s1 |
| InChIKey | OVNLILULPULKLY-XVDSASQMSA-M |
| XLogP | 4.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.82 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|