C18H32O2 — CID 145389257
(1R,6S,8R,11R)-2,4,4,11,14,14-hexamethyl-3,5-dioxatricyclo[6.5.1.02,6]tetradecane (PubChem CID 145389257) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (1R,6S,8R,11R)-2,4,4,11,14,14-hexamethyl-3,5-dioxatricyclo[6.5.1.02,6]tetradecane.
| Compound Name | (1R,6S,8R,11R)-2,4,4,11,14,14-hexamethyl-3,5-dioxatricyclo[6.5.1.02,6]tetradecane |
|---|---|
| PubChem CID | 145389257 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (1R,6S,8R,11R)-2,4,4,11,14,14-hexamethyl-3,5-dioxatricyclo[6.5.1.02,6]tetradecane |
| SMILES | C[C@@H]1CC[C@@H]2C[C@@H]3OC(C)(C)OC3(C)[C@H](CC1)C2(C)C |
| InChI | InChI=1S/C18H32O2/c1-12-7-9-13-11-15-18(6,20-17(4,5)19-15)14(10-8-12)16(13,2)3/h12-15H,7-11H2,1-6H3/t12-,13-,14-,15+,18?/m1/s1 |
| InChIKey | JNQDLGDUBYQSLS-WNFPOHNXSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |