C18H31NO3 — CID 59749991
N-butyl-2-[(2R)-4,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-2-yl]acetamide (PubChem CID 59749991) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is N-butyl-2-[(2R)-4,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-2-yl]acetamide.
| Compound Name | N-butyl-2-[(2R)-4,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-2-yl]acetamide |
|---|---|
| PubChem CID | 59749991 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | N-butyl-2-[(2R)-4,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-2-yl]acetamide |
| SMILES | CCCCNC(=O)C[C@]12OC(C)(C)OC1CC1CC2C1(C)C |
| InChI | InChI=1S/C18H31NO3/c1-6-7-8-19-15(20)11-18-13-9-12(16(13,2)3)10-14(18)21-17(4,5)22-18/h12-14H,6-11H2,1-5H3,(H,19,20)/t12?,13?,14?,18-/m1/s1 |
| InChIKey | AFESRIAHFFJUCH-VULNERIWSA-N |
| XLogP | 3.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|