C13H23NO4 — CID 74326466
N-butyl-2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)acetamide (PubChem CID 74326466) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-butyl-2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)acetamide.
| Compound Name | N-butyl-2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)acetamide |
|---|---|
| PubChem CID | 74326466 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-butyl-2-(6-formyl-2,2-dimethyl-1,3-dioxan-4-yl)acetamide |
| SMILES | CCCCNC(=O)CC1CC(C=O)OC(C)(C)O1 |
| InChI | InChI=1S/C13H23NO4/c1-4-5-6-14-12(16)8-10-7-11(9-15)18-13(2,3)17-10/h9-11H,4-8H2,1-3H3,(H,14,16) |
| InChIKey | LJQZNDUZOQPZGR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|