C13H22O2 — CID 143052736
2,5,5,7-tetramethyl-3,4,4a,6-tetrahydro-2H-chromen-8a-ol (PubChem CID 143052736) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 2,5,5,7-tetramethyl-3,4,4a,6-tetrahydro-2H-chromen-8a-ol.
| Compound Name | 2,5,5,7-tetramethyl-3,4,4a,6-tetrahydro-2H-chromen-8a-ol |
|---|---|
| PubChem CID | 143052736 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2,5,5,7-tetramethyl-3,4,4a,6-tetrahydro-2H-chromen-8a-ol |
| SMILES | CC1=CC2(O)OC(C)CCC2C(C)(C)C1 |
| InChI | InChI=1S/C13H22O2/c1-9-7-12(3,4)11-6-5-10(2)15-13(11,14)8-9/h8,10-11,14H,5-7H2,1-4H3 |
| InChIKey | FQQIBMRYQVVONZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|