C15H22Br2O2 — CID 163075541
(1R,3S,5S,6E,8R,11R)-11-bromo-6-(bromomethylidene)-5,8,12,12-tetramethyl-4,7-dioxatricyclo[6.4.0.03,5]dodecane (PubChem CID 163075541) has the molecular formula C15H22Br2O2 and a molecular weight of 394.15 g/mol. Its IUPAC name is (1R,3S,5S,6E,8R,11R)-11-bromo-6-(bromomethylidene)-5,8,12,12-tetramethyl-4,7-dioxatricyclo[6.4.0.03,5]dodecane.
| Compound Name | (1R,3S,5S,6E,8R,11R)-11-bromo-6-(bromomethylidene)-5,8,12,12-tetramethyl-4,7-dioxatricyclo[6.4.0.03,5]dodecane |
|---|---|
| PubChem CID | 163075541 |
| Molecular Formula | C15H22Br2O2 |
| Molecular Weight | 394.15 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | (1R,3S,5S,6E,8R,11R)-11-bromo-6-(bromomethylidene)-5,8,12,12-tetramethyl-4,7-dioxatricyclo[6.4.0.03,5]dodecane |
| SMILES | CC1(C)[C@H](Br)CC[C@@]2(C)O/C(=C/Br)[C@@]3(C)O[C@H]3C[C@H]12 |
| InChI | InChI=1S/C15H22Br2O2/c1-13(2)9-7-11-15(4,19-11)12(8-16)18-14(9,3)6-5-10(13)17/h8-11H,5-7H2,1-4H3/b12-8+/t9-,10-,11+,14-,15+/m1/s1 |
| InChIKey | JHYKYQBUFLQJDA-BCYBPIRJSA-N |
| XLogP | 4.76 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.15 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|