C15H28O2 — CID 14944769
(4aS,8aR)-2-methoxy-3,3,5,5,8a-pentamethyl-2,4,4a,6,7,8-hexahydrochromene (PubChem CID 14944769) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (4aS,8aR)-2-methoxy-3,3,5,5,8a-pentamethyl-2,4,4a,6,7,8-hexahydrochromene.
| Compound Name | (4aS,8aR)-2-methoxy-3,3,5,5,8a-pentamethyl-2,4,4a,6,7,8-hexahydrochromene |
|---|---|
| PubChem CID | 14944769 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (4aS,8aR)-2-methoxy-3,3,5,5,8a-pentamethyl-2,4,4a,6,7,8-hexahydrochromene |
| SMILES | COC1O[C@]2(C)CCCC(C)(C)[C@@H]2CC1(C)C |
| InChI | InChI=1S/C15H28O2/c1-13(2)8-7-9-15(5)11(13)10-14(3,4)12(16-6)17-15/h11-12H,7-10H2,1-6H3/t11-,12?,15+/m0/s1 |
| InChIKey | CBRPHOQCPUADMB-CPNOVKFWSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |