C8H18N2O — CID 174918997
2-N,2-N,2-N',2-N'-tetramethyloxolane-2,2-diamine (PubChem CID 174918997) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-N,2-N,2-N',2-N'-tetramethyloxolane-2,2-diamine.
| Compound Name | 2-N,2-N,2-N',2-N'-tetramethyloxolane-2,2-diamine |
|---|---|
| PubChem CID | 174918997 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 2-N,2-N,2-N',2-N'-tetramethyloxolane-2,2-diamine |
| SMILES | CN(C)C1(N(C)C)CCCO1 |
| InChI | InChI=1S/C8H18N2O/c1-9(2)8(10(3)4)6-5-7-11-8/h5-7H2,1-4H3 |
| InChIKey | BWMQPOHLEKHYQI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|