C7H10O — CID 89367197
spiro[bicyclo[1.1.0]butane-2,2'-oxolane] (PubChem CID 89367197) has the molecular formula C7H10O and a molecular weight of 110.16 g/mol. Its IUPAC name is spiro[bicyclo[1.1.0]butane-2,2'-oxolane].
| Compound Name | spiro[bicyclo[1.1.0]butane-2,2'-oxolane] |
|---|---|
| PubChem CID | 89367197 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | spiro[bicyclo[1.1.0]butane-2,2'-oxolane] |
| SMILES | C1COC2(C1)C1CC12 |
| InChI | InChI=1S/C7H10O/c1-2-7(8-3-1)5-4-6(5)7/h5-6H,1-4H2 |
| InChIKey | JSQUAABKBKALID-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |