About spiro[bicyclo[1.1.0]butane-2,2'-oxolane]
spiro[bicyclo[1.1.0]butane-2,2'-oxolane] (PubChem CID 89367197) has the molecular formula C7H10O
and a molecular weight of 110.16 g/mol. Its IUPAC name is spiro[bicyclo[1.1.0]butane-2,2'-oxolane].
Molecular Properties
| Compound Name | spiro[bicyclo[1.1.0]butane-2,2'-oxolane] |
| PubChem CID | 89367197 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | spiro[bicyclo[1.1.0]butane-2,2'-oxolane] |
| SMILES | C1COC2(C1)C1CC12 |
| InChI | InChI=1S/C7H10O/c1-2-7(8-3-1)5-4-6(5)7/h5-6H,1-4H2 |
| InChIKey | JSQUAABKBKALID-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[bicyclo[1.1.0]butane-2,2'-oxolane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[bicyclo[1.1.0]butane-2,2'-oxolane]?
The IUPAC name of spiro[bicyclo[1.1.0]butane-2,2'-oxolane] (CID 89367197) is spiro[bicyclo[1.1.0]butane-2,2'-oxolane].
What is the SMILES notation for spiro[bicyclo[1.1.0]butane-2,2'-oxolane]?
The canonical SMILES for spiro[bicyclo[1.1.0]butane-2,2'-oxolane] is C1COC2(C1)C1CC12.
What is the InChIKey of spiro[bicyclo[1.1.0]butane-2,2'-oxolane]?
The InChIKey is JSQUAABKBKALID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O/c1-2-7(8-3-1)5-4-6(5)7/h5-6H,1-4H2.
What are the key properties of spiro[bicyclo[1.1.0]butane-2,2'-oxolane]?
spiro[bicyclo[1.1.0]butane-2,2'-oxolane] has a molecular weight of 110.16 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[bicyclo[1.1.0]butane-2,2'-oxolane] is sourced from PubChem (CID 89367197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).