C7H16N2O2 — CID 151256492
2-N,2-N,2-N',2-N'-tetramethyl-1,3-dioxolane-2,2-diamine (PubChem CID 151256492) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-N,2-N,2-N',2-N'-tetramethyl-1,3-dioxolane-2,2-diamine.
| Compound Name | 2-N,2-N,2-N',2-N'-tetramethyl-1,3-dioxolane-2,2-diamine |
|---|---|
| PubChem CID | 151256492 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | 2-N,2-N,2-N',2-N'-tetramethyl-1,3-dioxolane-2,2-diamine |
| SMILES | CN(C)C1(N(C)C)OCCO1 |
| InChI | InChI=1S/C7H16N2O2/c1-8(2)7(9(3)4)10-5-6-11-7/h5-6H2,1-4H3 |
| InChIKey | NTKWWFIWKOQLII-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|