C14H20O2 — CID 102310420
8-(4-methylpenta-1,3-dienylidene)-1,4-dioxaspiro[4.5]decane (PubChem CID 102310420) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 8-(4-methylpenta-1,3-dienylidene)-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-(4-methylpenta-1,3-dienylidene)-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 102310420 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 8-(4-methylpenta-1,3-dienylidene)-1,4-dioxaspiro[4.5]decane |
| SMILES | CC(C)=CC=C=C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H20O2/c1-12(2)4-3-5-13-6-8-14(9-7-13)15-10-11-16-14/h3-4H,6-11H2,1-2H3 |
| InChIKey | ICOZJCKGWMOEFR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|