C11H19ClO — CID 79863526
9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane (PubChem CID 79863526) has the molecular formula C11H19ClO and a molecular weight of 202.72 g/mol. Its IUPAC name is 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane.
| Compound Name | 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane |
|---|---|
| PubChem CID | 79863526 |
| Molecular Formula | C11H19ClO |
| Molecular Weight | 202.72 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane |
| SMILES | CC1(C)CCCC12CC(Cl)CCO2 |
| InChI | InChI=1S/C11H19ClO/c1-10(2)5-3-6-11(10)8-9(12)4-7-13-11/h9H,3-8H2,1-2H3 |
| InChIKey | SKNYFMNVEODVJU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.72 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|