About 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane
9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane (PubChem CID 79863526) has the molecular formula C11H19ClO
and a molecular weight of 202.72 g/mol. Its IUPAC name is 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane |
| PubChem CID | 79863526 |
| Molecular Formula | C11H19ClO |
| Molecular Weight | 202.72 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane |
| SMILES | CC1(C)CCCC12CC(Cl)CCO2 |
| InChI | InChI=1S/C11H19ClO/c1-10(2)5-3-6-11(10)8-9(12)4-7-13-11/h9H,3-8H2,1-2H3 |
| InChIKey | SKNYFMNVEODVJU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.72 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane?
The IUPAC name of 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane (CID 79863526) is 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane.
What is the SMILES notation for 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane?
The canonical SMILES for 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane is CC1(C)CCCC12CC(Cl)CCO2.
What is the InChIKey of 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane?
The InChIKey is SKNYFMNVEODVJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19ClO/c1-10(2)5-3-6-11(10)8-9(12)4-7-13-11/h9H,3-8H2,1-2H3.
What are the key properties of 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane?
9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane has a molecular weight of 202.72 g/mol, XLogP of 3.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-4,4-dimethyl-6-oxaspiro[4.5]decane is sourced from PubChem (CID 79863526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).