C12H21ClO — CID 79852870
4-chloro-11,11-dimethyl-1-oxaspiro[5.5]undecane (PubChem CID 79852870) has the molecular formula C12H21ClO and a molecular weight of 216.75 g/mol. Its IUPAC name is 4-chloro-11,11-dimethyl-1-oxaspiro[5.5]undecane.
| Compound Name | 4-chloro-11,11-dimethyl-1-oxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 79852870 |
| Molecular Formula | C12H21ClO |
| Molecular Weight | 216.75 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 4-chloro-11,11-dimethyl-1-oxaspiro[5.5]undecane |
| SMILES | CC1(C)CCCCC12CC(Cl)CCO2 |
| InChI | InChI=1S/C12H21ClO/c1-11(2)6-3-4-7-12(11)9-10(13)5-8-14-12/h10H,3-9H2,1-2H3 |
| InChIKey | PLBIOPGPMMGUKA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.75 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|