About 1-oxaspiro[2.7]decane
1-oxaspiro[2.7]decane (PubChem CID 13240757) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is 1-oxaspiro[2.7]decane.
Molecular Properties
| Compound Name | 1-oxaspiro[2.7]decane |
| PubChem CID | 13240757 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 1-oxaspiro[2.7]decane |
| SMILES | C1CCCC2(CCC1)CO2 |
| InChI | InChI=1S/C9H16O/c1-2-4-6-9(8-10-9)7-5-3-1/h1-8H2 |
| InChIKey | BGJYHEFBQRQPTM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-oxaspiro[2.7]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxaspiro[2.7]decane?
The IUPAC name of 1-oxaspiro[2.7]decane (CID 13240757) is 1-oxaspiro[2.7]decane.
What is the SMILES notation for 1-oxaspiro[2.7]decane?
The canonical SMILES for 1-oxaspiro[2.7]decane is C1CCCC2(CCC1)CO2.
What is the InChIKey of 1-oxaspiro[2.7]decane?
The InChIKey is BGJYHEFBQRQPTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O/c1-2-4-6-9(8-10-9)7-5-3-1/h1-8H2.
What are the key properties of 1-oxaspiro[2.7]decane?
1-oxaspiro[2.7]decane has a molecular weight of 140.23 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxaspiro[2.7]decane is sourced from PubChem (CID 13240757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).