C9H12O3 — CID 165154842
2,7,11-trioxatrispiro[2.1.25.1.29.13]dodecane (PubChem CID 165154842) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 2,7,11-trioxatrispiro[2.1.25.1.29.13]dodecane.
| Compound Name | 2,7,11-trioxatrispiro[2.1.25.1.29.13]dodecane |
|---|---|
| PubChem CID | 165154842 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2,7,11-trioxatrispiro[2.1.25.1.29.13]dodecane |
| SMILES | C1OC12CC1(CO1)CC1(CO1)C2 |
| InChI | InChI=1S/C9H12O3/c1-7(4-10-7)2-9(6-12-9)3-8(1)5-11-8/h1-6H2 |
| InChIKey | UBAFTBAVENGPRA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 37.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|