About 1,8-dioxaspiro[2.6]nonane
1,8-dioxaspiro[2.6]nonane (PubChem CID 88652146) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is 1,8-dioxaspiro[2.6]nonane.
Molecular Properties
| Compound Name | 1,8-dioxaspiro[2.6]nonane |
| PubChem CID | 88652146 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 1,8-dioxaspiro[2.6]nonane |
| SMILES | C1CCC2(COC1)CO2 |
| InChI | InChI=1S/C7H12O2/c1-2-4-8-5-7(3-1)6-9-7/h1-6H2 |
| InChIKey | YUSWECSPBHUJJL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,8-dioxaspiro[2.6]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dioxaspiro[2.6]nonane?
The IUPAC name of 1,8-dioxaspiro[2.6]nonane (CID 88652146) is 1,8-dioxaspiro[2.6]nonane.
What is the SMILES notation for 1,8-dioxaspiro[2.6]nonane?
The canonical SMILES for 1,8-dioxaspiro[2.6]nonane is C1CCC2(COC1)CO2.
What is the InChIKey of 1,8-dioxaspiro[2.6]nonane?
The InChIKey is YUSWECSPBHUJJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-2-4-8-5-7(3-1)6-9-7/h1-6H2.
What are the key properties of 1,8-dioxaspiro[2.6]nonane?
1,8-dioxaspiro[2.6]nonane has a molecular weight of 128.17 g/mol, XLogP of 0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dioxaspiro[2.6]nonane is sourced from PubChem (CID 88652146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).