C14H24O6 — CID 140574841
2-hydroxy-2-(3-hydroxyheptan-3-yl)-1,3-dioxonane-4,9-dione (PubChem CID 140574841) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is 2-hydroxy-2-(3-hydroxyheptan-3-yl)-1,3-dioxonane-4,9-dione.
| Compound Name | 2-hydroxy-2-(3-hydroxyheptan-3-yl)-1,3-dioxonane-4,9-dione |
|---|---|
| PubChem CID | 140574841 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-hydroxy-2-(3-hydroxyheptan-3-yl)-1,3-dioxonane-4,9-dione |
| SMILES | CCCCC(O)(CC)C1(O)OC(=O)CCCCC(=O)O1 |
| InChI | InChI=1S/C14H24O6/c1-3-5-10-13(17,4-2)14(18)19-11(15)8-6-7-9-12(16)20-14/h17-18H,3-10H2,1-2H3 |
| InChIKey | UVNAGZOESRETHQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |