About 2,2-diethyl-5,6-dimethylidene-1,3-dioxan-4-one
2,2-diethyl-5,6-dimethylidene-1,3-dioxan-4-one (PubChem CID 123388125) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2,2-diethyl-5,6-dimethylidene-1,3-dioxan-4-one.
Molecular Properties
| Compound Name | 2,2-diethyl-5,6-dimethylidene-1,3-dioxan-4-one |
| PubChem CID | 123388125 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2,2-diethyl-5,6-dimethylidene-1,3-dioxan-4-one |
| SMILES | C=C1OC(CC)(CC)OC(=O)C1=C |
| InChI | InChI=1S/C10H14O3/c1-5-10(6-2)12-8(4)7(3)9(11)13-10/h3-6H2,1-2H3 |
| InChIKey | KNXIWAQWZXAHAJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethyl-5,6-dimethylidene-1,3-dioxan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-5,6-dimethylidene-1,3-dioxan-4-one?
The IUPAC name of 2,2-diethyl-5,6-dimethylidene-1,3-dioxan-4-one (CID 123388125) is 2,2-diethyl-5,6-dimethylidene-1,3-dioxan-4-one.
What is the SMILES notation for 2,2-diethyl-5,6-dimethylidene-1,3-dioxan-4-one?
The canonical SMILES for 2,2-diethyl-5,6-dimethylidene-1,3-dioxan-4-one is C=C1OC(CC)(CC)OC(=O)C1=C.
What is the InChIKey of 2,2-diethyl-5,6-dimethylidene-1,3-dioxan-4-one?
The InChIKey is KNXIWAQWZXAHAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-5-10(6-2)12-8(4)7(3)9(11)13-10/h3-6H2,1-2H3.
What are the key properties of 2,2-diethyl-5,6-dimethylidene-1,3-dioxan-4-one?
2,2-diethyl-5,6-dimethylidene-1,3-dioxan-4-one has a molecular weight of 182.22 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-5,6-dimethylidene-1,3-dioxan-4-one is sourced from PubChem (CID 123388125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).