C8H10O3 — CID 163588143
2-ethyl-5,6-dimethylidene-1,3-dioxan-4-one (PubChem CID 163588143) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 2-ethyl-5,6-dimethylidene-1,3-dioxan-4-one.
| Compound Name | 2-ethyl-5,6-dimethylidene-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 163588143 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2-ethyl-5,6-dimethylidene-1,3-dioxan-4-one |
| SMILES | C=C1OC(CC)OC(=O)C1=C |
| InChI | InChI=1S/C8H10O3/c1-4-7-10-6(3)5(2)8(9)11-7/h7H,2-4H2,1H3 |
| InChIKey | GNFYBGHPINGLNJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|