C21H21IO4 — CID 86276326
2-methyl-2-(2-methylpropyl)-5-[(4-phenylphenyl)-λ3-iodanylidene]-1,3-dioxane-4,6-dione (PubChem CID 86276326) has the molecular formula C21H21IO4 and a molecular weight of 464.30 g/mol. Its IUPAC name is 2-methyl-2-(2-methylpropyl)-5-[(4-phenylphenyl)-λ3-iodanylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2-methyl-2-(2-methylpropyl)-5-[(4-phenylphenyl)-λ3-iodanylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 86276326 |
| Molecular Formula | C21H21IO4 |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 2-methyl-2-(2-methylpropyl)-5-[(4-phenylphenyl)-λ3-iodanylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC(C)CC1(C)OC(=O)C(=Ic2ccc(-c3ccccc3)cc2)C(=O)O1 |
| InChI | InChI=1S/C21H21IO4/c1-14(2)13-21(3)25-19(23)18(20(24)26-21)22-17-11-9-16(10-12-17)15-7-5-4-6-8-15/h4-12,14H,13H2,1-3H3 |
| InChIKey | OMSUZIJVZYGNRO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|