C24H18N2 — CID 134977334
(E)-4,5-bis(2-phenylethynyl)oct-4-enedinitrile (PubChem CID 134977334) has the molecular formula C24H18N2 and a molecular weight of 334.42 g/mol. Its IUPAC name is (E)-4,5-bis(2-phenylethynyl)oct-4-enedinitrile.
| Compound Name | (E)-4,5-bis(2-phenylethynyl)oct-4-enedinitrile |
|---|---|
| PubChem CID | 134977334 |
| Molecular Formula | C24H18N2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (E)-4,5-bis(2-phenylethynyl)oct-4-enedinitrile |
| SMILES | N#CCC/C(C#Cc1ccccc1)=C(\C#Cc1ccccc1)CCC#N |
| InChI | InChI=1S/C24H18N2/c25-19-7-13-23(17-15-21-9-3-1-4-10-21)24(14-8-20-26)18-16-22-11-5-2-6-12-22/h1-6,9-12H,7-8,13-14H2/b24-23+ |
| InChIKey | JHOONJDXRMBNCU-WCWDXBQESA-N |
| XLogP | 4.99 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|