C25H21F3 — CID 154720792
1-phenyl-4-[(3S)-7,7,7-trifluoro-1-phenylhept-1-yn-3-yl]benzene (PubChem CID 154720792) has the molecular formula C25H21F3 and a molecular weight of 378.44 g/mol. Its IUPAC name is 1-phenyl-4-[(3S)-7,7,7-trifluoro-1-phenylhept-1-yn-3-yl]benzene.
| Compound Name | 1-phenyl-4-[(3S)-7,7,7-trifluoro-1-phenylhept-1-yn-3-yl]benzene |
|---|---|
| PubChem CID | 154720792 |
| Molecular Formula | C25H21F3 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-phenyl-4-[(3S)-7,7,7-trifluoro-1-phenylhept-1-yn-3-yl]benzene |
| SMILES | FC(F)(F)CCC[C@H](C#Cc1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21F3/c26-25(27,28)19-7-12-22(14-13-20-8-3-1-4-9-20)24-17-15-23(16-18-24)21-10-5-2-6-11-21/h1-6,8-11,15-18,22H,7,12,19H2/t22-/m1/s1 |
| InChIKey | WTEDKJDDKNKEED-JOCHJYFZSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|