C15H12F6 — CID 160611657
1,1'-biphenyl;1,1,1,3,3,3-hexafluoropropane (PubChem CID 160611657) has the molecular formula C15H12F6 and a molecular weight of 306.25 g/mol. Its IUPAC name is 1,1'-biphenyl;1,1,1,3,3,3-hexafluoropropane.
| Compound Name | 1,1'-biphenyl;1,1,1,3,3,3-hexafluoropropane |
|---|---|
| PubChem CID | 160611657 |
| Molecular Formula | C15H12F6 |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 1,1'-biphenyl;1,1,1,3,3,3-hexafluoropropane |
| SMILES | FC(F)(F)CC(F)(F)F.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C3H2F6/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;4-2(5,6)1-3(7,8)9/h1-10H;1H2 |
| InChIKey | RFOJDABBDZJDRE-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |