C14H18FNO4 — CID 67292937
3-(benzylamino)-5-fluoro-4,4-dimethoxypent-2-enoic acid (PubChem CID 67292937) has the molecular formula C14H18FNO4 and a molecular weight of 283.30 g/mol. Its IUPAC name is 3-(benzylamino)-5-fluoro-4,4-dimethoxypent-2-enoic acid.
| Compound Name | 3-(benzylamino)-5-fluoro-4,4-dimethoxypent-2-enoic acid |
|---|---|
| PubChem CID | 67292937 |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-(benzylamino)-5-fluoro-4,4-dimethoxypent-2-enoic acid |
| SMILES | COC(CF)(OC)C(=CC(=O)O)NCc1ccccc1 |
| InChI | InChI=1S/C14H18FNO4/c1-19-14(10-15,20-2)12(8-13(17)18)16-9-11-6-4-3-5-7-11/h3-8,16H,9-10H2,1-2H3,(H,17,18) |
| InChIKey | JWBBQKITBZGQNC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|