C17H23NO2 — CID 132518019
(Z)-1-(benzylamino)dec-1-ene-3,6-dione (PubChem CID 132518019) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (Z)-1-(benzylamino)dec-1-ene-3,6-dione.
| Compound Name | (Z)-1-(benzylamino)dec-1-ene-3,6-dione |
|---|---|
| PubChem CID | 132518019 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (Z)-1-(benzylamino)dec-1-ene-3,6-dione |
| SMILES | CCCCC(=O)CCC(=O)/C=C\NCc1ccccc1 |
| InChI | InChI=1S/C17H23NO2/c1-2-3-9-16(19)10-11-17(20)12-13-18-14-15-7-5-4-6-8-15/h4-8,12-13,18H,2-3,9-11,14H2,1H3/b13-12- |
| InChIKey | WKGOEWGXONTDMP-SEYXRHQNSA-N |
| XLogP | 3.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|