C13H21NO2 — CID 115724145
2-(3-phenylbutan-2-ylamino)propane-1,3-diol (PubChem CID 115724145) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(3-phenylbutan-2-ylamino)propane-1,3-diol.
| Compound Name | 2-(3-phenylbutan-2-ylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 115724145 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 2-(3-phenylbutan-2-ylamino)propane-1,3-diol |
| SMILES | CC(NC(CO)CO)C(C)c1ccccc1 |
| InChI | InChI=1S/C13H21NO2/c1-10(12-6-4-3-5-7-12)11(2)14-13(8-15)9-16/h3-7,10-11,13-16H,8-9H2,1-2H3 |
| InChIKey | ZRHWQFFYLLVRAX-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |