C18H23NO — CID 173345739
(2R)-2-amino-4-methyl-5,5-diphenylpentan-1-ol (PubChem CID 173345739) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is (2R)-2-amino-4-methyl-5,5-diphenylpentan-1-ol.
| Compound Name | (2R)-2-amino-4-methyl-5,5-diphenylpentan-1-ol |
|---|---|
| PubChem CID | 173345739 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | (2R)-2-amino-4-methyl-5,5-diphenylpentan-1-ol |
| SMILES | CC(C[C@@H](N)CO)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H23NO/c1-14(12-17(19)13-20)18(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,14,17-18,20H,12-13,19H2,1H3/t14?,17-/m1/s1 |
| InChIKey | UKEOMJLFOKWTDR-FBMWCMRBSA-N |
| XLogP | 3.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |