About (3-hydroxy-2-phenylpropyl)-λ2-stannane
(3-hydroxy-2-phenylpropyl)-λ2-stannane (PubChem CID 173264317) has the molecular formula C9H12OSn
and a molecular weight of 254.91 g/mol. Its IUPAC name is (3-hydroxy-2-phenylpropyl)-λ2-stannane.
Molecular Properties
| Compound Name | (3-hydroxy-2-phenylpropyl)-λ2-stannane |
| PubChem CID | 173264317 |
| Molecular Formula | C9H12OSn |
| Molecular Weight | 254.91 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | (3-hydroxy-2-phenylpropyl)-λ2-stannane |
| SMILES | OCC(C[SnH])c1ccccc1 |
| InChI | InChI=1S/C9H11O.Sn.H/c1-8(7-10)9-5-3-2-4-6-9;;/h2-6,8,10H,1,7H2;; |
| InChIKey | SDJISXFTVMUESW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.91 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-hydroxy-2-phenylpropyl)-λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2-phenylpropyl)-λ2-stannane?
The IUPAC name of (3-hydroxy-2-phenylpropyl)-λ2-stannane (CID 173264317) is (3-hydroxy-2-phenylpropyl)-λ2-stannane.
What is the SMILES notation for (3-hydroxy-2-phenylpropyl)-λ2-stannane?
The canonical SMILES for (3-hydroxy-2-phenylpropyl)-λ2-stannane is OCC(C[SnH])c1ccccc1.
What is the InChIKey of (3-hydroxy-2-phenylpropyl)-λ2-stannane?
The InChIKey is SDJISXFTVMUESW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O.Sn.H/c1-8(7-10)9-5-3-2-4-6-9;;/h2-6,8,10H,1,7H2;;.
What are the key properties of (3-hydroxy-2-phenylpropyl)-λ2-stannane?
(3-hydroxy-2-phenylpropyl)-λ2-stannane has a molecular weight of 254.91 g/mol, XLogP of 1.08, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2-phenylpropyl)-λ2-stannane is sourced from PubChem (CID 173264317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).