C16H26O2 — CID 58432679
(2R,4R)-2-tert-butyl-2-methyl-4-phenylpentane-1,5-diol (PubChem CID 58432679) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (2R,4R)-2-tert-butyl-2-methyl-4-phenylpentane-1,5-diol.
| Compound Name | (2R,4R)-2-tert-butyl-2-methyl-4-phenylpentane-1,5-diol |
|---|---|
| PubChem CID | 58432679 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (2R,4R)-2-tert-butyl-2-methyl-4-phenylpentane-1,5-diol |
| SMILES | CC(C)(C)[C@](C)(CO)C[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C16H26O2/c1-15(2,3)16(4,12-18)10-14(11-17)13-8-6-5-7-9-13/h5-9,14,17-18H,10-12H2,1-4H3/t14-,16-/m0/s1 |
| InChIKey | LDLUNEGFHPUJFY-HOCLYGCPSA-N |
| XLogP | 3.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |