C16H19Cl2NO2 — CID 110184492
[1-[4-[(4-chlorophenyl)methoxy]phenyl]-1-hydroxypropan-2-yl]azanium chloride (PubChem CID 110184492) has the molecular formula C16H19Cl2NO2 and a molecular weight of 328.24 g/mol. Its IUPAC name is [1-[4-[(4-chlorophenyl)methoxy]phenyl]-1-hydroxypropan-2-yl]azanium chloride.
| Compound Name | [1-[4-[(4-chlorophenyl)methoxy]phenyl]-1-hydroxypropan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 110184492 |
| Molecular Formula | C16H19Cl2NO2 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | [1-[4-[(4-chlorophenyl)methoxy]phenyl]-1-hydroxypropan-2-yl]azanium chloride |
| SMILES | CC([NH3+])C(O)c1ccc(OCc2ccc(Cl)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C16H18ClNO2.ClH/c1-11(18)16(19)13-4-8-15(9-5-13)20-10-12-2-6-14(17)7-3-12;/h2-9,11,16,19H,10,18H2,1H3;1H |
| InChIKey | CHMBLCUYWSJLMO-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 57.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |