C17H22ClNO2 — CID 110184490
[1-hydroxy-1-[4-[(3-methylphenyl)methoxy]phenyl]propan-2-yl]azanium chloride (PubChem CID 110184490) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is [1-hydroxy-1-[4-[(3-methylphenyl)methoxy]phenyl]propan-2-yl]azanium chloride.
| Compound Name | [1-hydroxy-1-[4-[(3-methylphenyl)methoxy]phenyl]propan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 110184490 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | [1-hydroxy-1-[4-[(3-methylphenyl)methoxy]phenyl]propan-2-yl]azanium chloride |
| SMILES | Cc1cccc(COc2ccc(C(O)C(C)[NH3+])cc2)c1.[Cl-] |
| InChI | InChI=1S/C17H21NO2.ClH/c1-12-4-3-5-14(10-12)11-20-16-8-6-15(7-9-16)17(19)13(2)18;/h3-10,13,17,19H,11,18H2,1-2H3;1H |
| InChIKey | UGDQIWDZSMIMIN-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 57.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |