C35H68OSn2 — CID 10930655
(1S,2R)-1-phenyl-4-tributylstannyl-2-(tributylstannylmethyl)butan-1-ol (PubChem CID 10930655) has the molecular formula C35H68OSn2 and a molecular weight of 742.35 g/mol. Its IUPAC name is (1S,2R)-1-phenyl-4-tributylstannyl-2-(tributylstannylmethyl)butan-1-ol.
| Compound Name | (1S,2R)-1-phenyl-4-tributylstannyl-2-(tributylstannylmethyl)butan-1-ol |
|---|---|
| PubChem CID | 10930655 |
| Molecular Formula | C35H68OSn2 |
| Molecular Weight | 742.35 g/mol |
| Exact Mass | 744.33 |
| IUPAC Name | (1S,2R)-1-phenyl-4-tributylstannyl-2-(tributylstannylmethyl)butan-1-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)CC[C@@H](C[Sn](CCCC)(CCCC)CCCC)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C11H14O.6C4H9.2Sn/c1-3-9(2)11(12)10-7-5-4-6-8-10;6*1-3-4-2;;/h4-9,11-12H,1-3H2;6*1,3-4H2,2H3;;/t9-,11+;;;;;;;;/m1......../s1 |
| InChIKey | VUTUOQHQZRZOHM-JUCFVGPDSA-N |
| XLogP | 12.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.35 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |