C23H30N2O5 — CID 91099931
tert-butyl N-(2-hydroxy-1-phenylethyl)-N-[3-oxo-3-(phenylmethoxyamino)propyl]carbamate (PubChem CID 91099931) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxy-1-phenylethyl)-N-[3-oxo-3-(phenylmethoxyamino)propyl]carbamate.
| Compound Name | tert-butyl N-(2-hydroxy-1-phenylethyl)-N-[3-oxo-3-(phenylmethoxyamino)propyl]carbamate |
|---|---|
| PubChem CID | 91099931 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | tert-butyl N-(2-hydroxy-1-phenylethyl)-N-[3-oxo-3-(phenylmethoxyamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCC(=O)NOCc1ccccc1)C(CO)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O5/c1-23(2,3)30-22(28)25(20(16-26)19-12-8-5-9-13-19)15-14-21(27)24-29-17-18-10-6-4-7-11-18/h4-13,20,26H,14-17H2,1-3H3,(H,24,27) |
| InChIKey | OISBIISSEGFMIV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|