C21H29FO6 — CID 102488380
3-O-tert-butyl 1-O,1-O-diethyl (2S,3S)-1-fluoro-2-phenylbutane-1,1,3-tricarboxylate (PubChem CID 102488380) has the molecular formula C21H29FO6 and a molecular weight of 396.46 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O,1-O-diethyl (2S,3S)-1-fluoro-2-phenylbutane-1,1,3-tricarboxylate.
| Compound Name | 3-O-tert-butyl 1-O,1-O-diethyl (2S,3S)-1-fluoro-2-phenylbutane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 102488380 |
| Molecular Formula | C21H29FO6 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 3-O-tert-butyl 1-O,1-O-diethyl (2S,3S)-1-fluoro-2-phenylbutane-1,1,3-tricarboxylate |
| SMILES | CCOC(=O)C(F)(C(=O)OCC)[C@H](c1ccccc1)[C@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H29FO6/c1-7-26-18(24)21(22,19(25)27-8-2)16(15-12-10-9-11-13-15)14(3)17(23)28-20(4,5)6/h9-14,16H,7-8H2,1-6H3/t14-,16-/m0/s1 |
| InChIKey | LFSKPFXNGMUOOU-HOCLYGCPSA-N |
| XLogP | 3.58 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|