C16H23NO4 — CID 70336338
4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate (PubChem CID 70336338) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate.
| Compound Name | 4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate |
|---|---|
| PubChem CID | 70336338 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate |
| SMILES | CCOC(=O)C(c1cccnc1)[C@@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23NO4/c1-6-20-15(19)13(12-8-7-9-17-10-12)11(2)14(18)21-16(3,4)5/h7-11,13H,6H2,1-5H3/t11-,13?/m1/s1 |
| InChIKey | DWBFUDGSNFPNEL-JTDNENJMSA-N |
| XLogP | 2.71 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |