4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate

C16H23NO4 — CID 70336338

IUPAC4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate
SMILESCCOC(=O)C(c1cccnc1)[C@@H](C)C(=O)OC(C)(C)C
InChIInChI=1S/C16H23NO4/c1-6-20-15(19)13(12-8-7-9-17-10-12)11(2)14(18)21-16(3,4)5/h7-11,13H,6H2,1-5H3/t11-,13?/m1/s1
InChIKeyDWBFUDGSNFPNEL-JTDNENJMSA-N
MW293.36 g/mol
LogP2.71
Rot. Bonds5

About 4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate

4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate (PubChem CID 70336338) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate.

Molecular Properties

Compound Name4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate
PubChem CID70336338
Molecular FormulaC16H23NO4
Molecular Weight293.36 g/mol
Exact Mass293.16
IUPAC Name4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate
SMILESCCOC(=O)C(c1cccnc1)[C@@H](C)C(=O)OC(C)(C)C
InChIInChI=1S/C16H23NO4/c1-6-20-15(19)13(12-8-7-9-17-10-12)11(2)14(18)21-16(3,4)5/h7-11,13H,6H2,1-5H3/t11-,13?/m1/s1
InChIKeyDWBFUDGSNFPNEL-JTDNENJMSA-N
XLogP2.71
TPSA65.49 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.36
LogP ≤ 52.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate?
The IUPAC name of 4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate (CID 70336338) is 4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate.
What is the SMILES notation for 4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate?
The canonical SMILES for 4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate is CCOC(=O)C(c1cccnc1)[C@@H](C)C(=O)OC(C)(C)C.
What is the InChIKey of 4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate?
The InChIKey is DWBFUDGSNFPNEL-JTDNENJMSA-N. The full InChI is InChI=1S/C16H23NO4/c1-6-20-15(19)13(12-8-7-9-17-10-12)11(2)14(18)21-16(3,4)5/h7-11,13H,6H2,1-5H3/t11-,13?/m1/s1.
What are the key properties of 4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate?
4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate has a molecular weight of 293.36 g/mol, XLogP of 2.71, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 1-O-ethyl (3R)-3-methyl-2-pyridin-3-ylbutanedioate is sourced from PubChem (CID 70336338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).