About 1-O-tert-butyl 5-O-methyl 3-phenyl-2-pyridin-3-ylpentanedioate;methylphosphane
1-O-tert-butyl 5-O-methyl 3-phenyl-2-pyridin-3-ylpentanedioate;methylphosphane (PubChem CID 143402441) has the molecular formula C22H30NO4P
and a molecular weight of 403.46 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-methyl 3-phenyl-2-pyridin-3-ylpentanedioate;methylphosphane.
Molecular Properties
| Compound Name | 1-O-tert-butyl 5-O-methyl 3-phenyl-2-pyridin-3-ylpentanedioate;methylphosphane |
| PubChem CID | 143402441 |
| Molecular Formula | C22H30NO4P |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 1-O-tert-butyl 5-O-methyl 3-phenyl-2-pyridin-3-ylpentanedioate;methylphosphane |
| SMILES | COC(=O)CC(c1ccccc1)C(C(=O)OC(C)(C)C)c1cccnc1.CP |
| InChI | InChI=1S/C21H25NO4.CH5P/c1-21(2,3)26-20(24)19(16-11-8-12-22-14-16)17(13-18(23)25-4)15-9-6-5-7-10-15;1-2/h5-12,14,17,19H,13H2,1-4H3;2H2,1H3 |
| InChIKey | SMSGLFASTFNGFW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 5-O-methyl 3-phenyl-2-pyridin-3-ylpentanedioate;methylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 5-O-methyl 3-phenyl-2-pyridin-3-ylpentanedioate;methylphosphane?
The IUPAC name of 1-O-tert-butyl 5-O-methyl 3-phenyl-2-pyridin-3-ylpentanedioate;methylphosphane (CID 143402441) is 1-O-tert-butyl 5-O-methyl 3-phenyl-2-pyridin-3-ylpentanedioate;methylphosphane.
What is the SMILES notation for 1-O-tert-butyl 5-O-methyl 3-phenyl-2-pyridin-3-ylpentanedioate;methylphosphane?
The canonical SMILES for 1-O-tert-butyl 5-O-methyl 3-phenyl-2-pyridin-3-ylpentanedioate;methylphosphane is COC(=O)CC(c1ccccc1)C(C(=O)OC(C)(C)C)c1cccnc1.CP.
What is the InChIKey of 1-O-tert-butyl 5-O-methyl 3-phenyl-2-pyridin-3-ylpentanedioate;methylphosphane?
The InChIKey is SMSGLFASTFNGFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO4.CH5P/c1-21(2,3)26-20(24)19(16-11-8-12-22-14-16)17(13-18(23)25-4)15-9-6-5-7-10-15;1-2/h5-12,14,17,19H,13H2,1-4H3;2H2,1H3.
What are the key properties of 1-O-tert-butyl 5-O-methyl 3-phenyl-2-pyridin-3-ylpentanedioate;methylphosphane?
1-O-tert-butyl 5-O-methyl 3-phenyl-2-pyridin-3-ylpentanedioate;methylphosphane has a molecular weight of 403.46 g/mol, XLogP of 4.35, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 5-O-methyl 3-phenyl-2-pyridin-3-ylpentanedioate;methylphosphane is sourced from PubChem (CID 143402441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).