C23H29BN2O3 — CID 88971303
CID 88971303 (PubChem CID 88971303) has the molecular formula C23H29BN2O3 and a molecular weight of 392.31 g/mol.
| Compound Name | CID 88971303 |
|---|---|
| PubChem CID | 88971303 |
| Molecular Formula | C23H29BN2O3 |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(C(CC(=O)OC)C(C(=O)N(C(C)C)C(C)C)c2cccnc2)c1 |
| InChI | InChI=1S/C23H29BN2O3/c1-15(2)26(16(3)4)23(28)22(18-9-7-11-25-14-18)20(13-21(27)29-5)17-8-6-10-19(24)12-17/h6-12,14-16,20,22H,13H2,1-5H3 |
| InChIKey | ICFDUJFVTZBIQF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|