C22H28N2O4 — CID 143402411
methyl 5-[1-hydroxyethyl(propan-2-yl)amino]-5-oxo-3-phenyl-4-pyridin-3-ylpentanoate (PubChem CID 143402411) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is methyl 5-[1-hydroxyethyl(propan-2-yl)amino]-5-oxo-3-phenyl-4-pyridin-3-ylpentanoate.
| Compound Name | methyl 5-[1-hydroxyethyl(propan-2-yl)amino]-5-oxo-3-phenyl-4-pyridin-3-ylpentanoate |
|---|---|
| PubChem CID | 143402411 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | methyl 5-[1-hydroxyethyl(propan-2-yl)amino]-5-oxo-3-phenyl-4-pyridin-3-ylpentanoate |
| SMILES | COC(=O)CC(c1ccccc1)C(C(=O)N(C(C)C)C(C)O)c1cccnc1 |
| InChI | InChI=1S/C22H28N2O4/c1-15(2)24(16(3)25)22(27)21(18-11-8-12-23-14-18)19(13-20(26)28-4)17-9-6-5-7-10-17/h5-12,14-16,19,21,25H,13H2,1-4H3 |
| InChIKey | GSSQNZXFJJIOJJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|