C18H22N2O3 — CID 15544536
methyl 3-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-3-pyridin-3-ylpropanoate (PubChem CID 15544536) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is methyl 3-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-3-pyridin-3-ylpropanoate.
| Compound Name | methyl 3-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-3-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 15544536 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | methyl 3-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-3-pyridin-3-ylpropanoate |
| SMILES | COC(=O)CC(N[C@@H](C)c1ccc(OC)cc1)c1cccnc1 |
| InChI | InChI=1S/C18H22N2O3/c1-13(14-6-8-16(22-2)9-7-14)20-17(11-18(21)23-3)15-5-4-10-19-12-15/h4-10,12-13,17,20H,11H2,1-3H3/t13-,17?/m0/s1 |
| InChIKey | NBSAJZZTYKLZNU-CWQZNGJJSA-N |
| XLogP | 3.05 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |