C19H24N2O3 — CID 101157279
ethyl (3S)-3-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-3-pyridin-2-ylpropanoate (PubChem CID 101157279) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is ethyl (3S)-3-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-3-pyridin-2-ylpropanoate.
| Compound Name | ethyl (3S)-3-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-3-pyridin-2-ylpropanoate |
|---|---|
| PubChem CID | 101157279 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | ethyl (3S)-3-[[(1S)-1-(4-methoxyphenyl)ethyl]amino]-3-pyridin-2-ylpropanoate |
| SMILES | CCOC(=O)C[C@H](N[C@@H](C)c1ccc(OC)cc1)c1ccccn1 |
| InChI | InChI=1S/C19H24N2O3/c1-4-24-19(22)13-18(17-7-5-6-12-20-17)21-14(2)15-8-10-16(23-3)11-9-15/h5-12,14,18,21H,4,13H2,1-3H3/t14-,18-/m0/s1 |
| InChIKey | VPZKYCQORYVQFH-KSSFIOAISA-N |
| XLogP | 3.44 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |