C10H14N2O4 — CID 171865570
ethyl 2,3-dihydroxy-3-(4-methylpyrimidin-2-yl)propanoate (PubChem CID 171865570) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-(4-methylpyrimidin-2-yl)propanoate.
| Compound Name | ethyl 2,3-dihydroxy-3-(4-methylpyrimidin-2-yl)propanoate |
|---|---|
| PubChem CID | 171865570 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | ethyl 2,3-dihydroxy-3-(4-methylpyrimidin-2-yl)propanoate |
| SMILES | CCOC(=O)C(O)C(O)c1nccc(C)n1 |
| InChI | InChI=1S/C10H14N2O4/c1-3-16-10(15)8(14)7(13)9-11-5-4-6(2)12-9/h4-5,7-8,13-14H,3H2,1-2H3 |
| InChIKey | SOMFFINEFASQDQ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |