C11H11F2NO4 — CID 171868759
3-(5-acetyl-2,4-difluorophenyl)-2,3-dihydroxypropanamide (PubChem CID 171868759) has the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. Its IUPAC name is 3-(5-acetyl-2,4-difluorophenyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(5-acetyl-2,4-difluorophenyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171868759 |
| Molecular Formula | C11H11F2NO4 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 3-(5-acetyl-2,4-difluorophenyl)-2,3-dihydroxypropanamide |
| SMILES | CC(=O)c1cc(C(O)C(O)C(N)=O)c(F)cc1F |
| InChI | InChI=1S/C11H11F2NO4/c1-4(15)5-2-6(8(13)3-7(5)12)9(16)10(17)11(14)18/h2-3,9-10,16-17H,1H3,(H2,14,18) |
| InChIKey | DODXNGTZRWUSSN-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |