C11H14FNO4 — CID 171868483
3-(2-ethoxy-5-fluorophenyl)-2,3-dihydroxypropanamide (PubChem CID 171868483) has the molecular formula C11H14FNO4 and a molecular weight of 243.23 g/mol. Its IUPAC name is 3-(2-ethoxy-5-fluorophenyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(2-ethoxy-5-fluorophenyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171868483 |
| Molecular Formula | C11H14FNO4 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 3-(2-ethoxy-5-fluorophenyl)-2,3-dihydroxypropanamide |
| SMILES | CCOc1ccc(F)cc1C(O)C(O)C(N)=O |
| InChI | InChI=1S/C11H14FNO4/c1-2-17-8-4-3-6(12)5-7(8)9(14)10(15)11(13)16/h3-5,9-10,14-15H,2H2,1H3,(H2,13,16) |
| InChIKey | UVVRGZQQEIBACN-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |