C9H12ClFN2O2 — CID 171893440
1-(2-amino-5-fluoro-3-pyridinyl)-4-chlorobutane-1,2-diol (PubChem CID 171893440) has the molecular formula C9H12ClFN2O2 and a molecular weight of 234.66 g/mol. Its IUPAC name is 1-(2-amino-5-fluoro-3-pyridinyl)-4-chlorobutane-1,2-diol.
| Compound Name | 1-(2-amino-5-fluoro-3-pyridinyl)-4-chlorobutane-1,2-diol |
|---|---|
| PubChem CID | 171893440 |
| Molecular Formula | C9H12ClFN2O2 |
| Molecular Weight | 234.66 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 1-(2-amino-5-fluoro-3-pyridinyl)-4-chlorobutane-1,2-diol |
| SMILES | Nc1ncc(F)cc1C(O)C(O)CCCl |
| InChI | InChI=1S/C9H12ClFN2O2/c10-2-1-7(14)8(15)6-3-5(11)4-13-9(6)12/h3-4,7-8,14-15H,1-2H2,(H2,12,13) |
| InChIKey | OJMWDIFFFMTJHS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.66 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|