C11H14FNO3 — CID 171881176
3-(4-amino-1,2-dihydroxybutyl)-5-fluorobenzaldehyde (PubChem CID 171881176) has the molecular formula C11H14FNO3 and a molecular weight of 227.24 g/mol. Its IUPAC name is 3-(4-amino-1,2-dihydroxybutyl)-5-fluorobenzaldehyde.
| Compound Name | 3-(4-amino-1,2-dihydroxybutyl)-5-fluorobenzaldehyde |
|---|---|
| PubChem CID | 171881176 |
| Molecular Formula | C11H14FNO3 |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 3-(4-amino-1,2-dihydroxybutyl)-5-fluorobenzaldehyde |
| SMILES | NCCC(O)C(O)c1cc(F)cc(C=O)c1 |
| InChI | InChI=1S/C11H14FNO3/c12-9-4-7(6-14)3-8(5-9)11(16)10(15)1-2-13/h3-6,10-11,15-16H,1-2,13H2 |
| InChIKey | WVFAIJGBDZMXDK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|