C36H41N7O2 — CID 168968674
4-[3-[[bis(pyridin-2-ylmethyl)amino]methyl]-5-[[2-ethenyliminobut-3-enyl(pyridin-2-ylmethyl)amino]methyl]phenoxy]butanamide (PubChem CID 168968674) has the molecular formula C36H41N7O2 and a molecular weight of 603.77 g/mol. Its IUPAC name is 4-[3-[[bis(pyridin-2-ylmethyl)amino]methyl]-5-[[2-ethenyliminobut-3-enyl(pyridin-2-ylmethyl)amino]methyl]phenoxy]butanamide.
| Compound Name | 4-[3-[[bis(pyridin-2-ylmethyl)amino]methyl]-5-[[2-ethenyliminobut-3-enyl(pyridin-2-ylmethyl)amino]methyl]phenoxy]butanamide |
|---|---|
| PubChem CID | 168968674 |
| Molecular Formula | C36H41N7O2 |
| Molecular Weight | 603.77 g/mol |
| Exact Mass | 603.33 |
| IUPAC Name | 4-[3-[[bis(pyridin-2-ylmethyl)amino]methyl]-5-[[2-ethenyliminobut-3-enyl(pyridin-2-ylmethyl)amino]methyl]phenoxy]butanamide |
| SMILES | C=C/N=C(\C=C)CN(Cc1cc(CN(Cc2ccccn2)Cc2ccccn2)cc(OCCCC(N)=O)c1)Cc1ccccn1 |
| InChI | InChI=1S/C36H41N7O2/c1-3-31(38-4-2)25-42(26-32-12-5-8-16-39-32)23-29-20-30(22-35(21-29)45-19-11-15-36(37)44)24-43(27-33-13-6-9-17-40-33)28-34-14-7-10-18-41-34/h3-10,12-14,16-18,20-22H,1-2,11,15,19,23-28H2,(H2,37,44)/b38-31+ |
| InChIKey | UYNMXUCRANSMJW-KPITYXSVSA-N |
| XLogP | 5.49 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.77 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|