C60H63N7O3 — CID 162509989
[(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[4-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]butyl]-N-[(4-phenylphenyl)methyl]carbamate (PubChem CID 162509989) has the molecular formula C60H63N7O3 and a molecular weight of 930.21 g/mol. Its IUPAC name is [(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[4-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]butyl]-N-[(4-phenylphenyl)methyl]carbamate.
| Compound Name | [(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[4-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]butyl]-N-[(4-phenylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 162509989 |
| Molecular Formula | C60H63N7O3 |
| Molecular Weight | 930.21 g/mol |
| Exact Mass | 929.50 |
| IUPAC Name | [(1R,8S)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[4-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]phenoxy]butyl]-N-[(4-phenylphenyl)methyl]carbamate |
| SMILES | O=C(OCC1[C@H]2CCC#CCC[C@@H]12)N(CCCCOc1cc(CN(Cc2ccccn2)Cc2ccccn2)cc(CN(Cc2ccccn2)Cc2ccccn2)c1)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C60H63N7O3/c68-60(70-46-59-57-24-6-1-2-7-25-58(57)59)67(41-47-26-28-51(29-27-47)50-18-4-3-5-19-50)34-16-17-35-69-56-37-48(39-65(42-52-20-8-12-30-61-52)43-53-21-9-13-31-62-53)36-49(38-56)40-66(44-54-22-10-14-32-63-54)45-55-23-11-15-33-64-55/h3-5,8-15,18-23,26-33,36-38,57-59H,6-7,16-17,24-25,34-35,39-46H2/t57-,58+,59? |
| InChIKey | VKBIWJDARLUPGW-JNBBYHOZSA-N |
| XLogP | 11.58 |
| TPSA | 96.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.21 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|