C32H30Br2N6 — CID 44598640
1-[3-[[bis[(6-bromo-2-pyridinyl)methyl]amino]methyl]phenyl]-N,N-bis(pyridin-2-ylmethyl)methanamine (PubChem CID 44598640) has the molecular formula C32H30Br2N6 and a molecular weight of 658.44 g/mol. Its IUPAC name is 1-[3-[[bis[(6-bromo-2-pyridinyl)methyl]amino]methyl]phenyl]-N,N-bis(pyridin-2-ylmethyl)methanamine.
| Compound Name | 1-[3-[[bis[(6-bromo-2-pyridinyl)methyl]amino]methyl]phenyl]-N,N-bis(pyridin-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 44598640 |
| Molecular Formula | C32H30Br2N6 |
| Molecular Weight | 658.44 g/mol |
| Exact Mass | 656.09 |
| IUPAC Name | 1-[3-[[bis[(6-bromo-2-pyridinyl)methyl]amino]methyl]phenyl]-N,N-bis(pyridin-2-ylmethyl)methanamine |
| SMILES | Brc1cccc(CN(Cc2cccc(CN(Cc3ccccn3)Cc3ccccn3)c2)Cc2cccc(Br)n2)n1 |
| InChI | InChI=1S/C32H30Br2N6/c33-31-14-6-12-29(37-31)23-40(24-30-13-7-15-32(34)38-30)20-26-9-5-8-25(18-26)19-39(21-27-10-1-3-16-35-27)22-28-11-2-4-17-36-28/h1-18H,19-24H2 |
| InChIKey | BZLYEPTYOQMWQZ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.44 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|